C14H8F3N3OS2 — CID 71610082
(5E)-2-amino-5-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methylidene]-1,3-thiazol-4-one (PubChem CID 71610082) has the molecular formula C14H8F3N3OS2 and a molecular weight of 355.37 g/mol. Its IUPAC name is (5E)-2-amino-5-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5E)-2-amino-5-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 71610082 |
| Molecular Formula | C14H8F3N3OS2 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | (5E)-2-amino-5-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methylidene]-1,3-thiazol-4-one |
| SMILES | NC1=NC(=O)/C(=C\c2csc(-c3ccc(C(F)(F)F)cc3)n2)S1 |
| InChI | InChI=1S/C14H8F3N3OS2/c15-14(16,17)8-3-1-7(2-4-8)12-19-9(6-22-12)5-10-11(21)20-13(18)23-10/h1-6H,(H2,18,20,21)/b10-5+ |
| InChIKey | UCIUWYIJNVMZNY-BJMVGYQFSA-N |
| XLogP | 3.76 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|