C31H37N5O6S — CID 71610705
6-butoxy-4-[3-cyclopentyl-5-(hydroxymethyl)anilino]-7-(2,4-dimethoxypyrimidin-5-yl)quinoline-3-sulfonamide (PubChem CID 71610705) has the molecular formula C31H37N5O6S and a molecular weight of 607.73 g/mol. Its IUPAC name is 6-butoxy-4-[3-cyclopentyl-5-(hydroxymethyl)anilino]-7-(2,4-dimethoxypyrimidin-5-yl)quinoline-3-sulfonamide.
| Compound Name | 6-butoxy-4-[3-cyclopentyl-5-(hydroxymethyl)anilino]-7-(2,4-dimethoxypyrimidin-5-yl)quinoline-3-sulfonamide |
|---|---|
| PubChem CID | 71610705 |
| Molecular Formula | C31H37N5O6S |
| Molecular Weight | 607.73 g/mol |
| Exact Mass | 607.25 |
| IUPAC Name | 6-butoxy-4-[3-cyclopentyl-5-(hydroxymethyl)anilino]-7-(2,4-dimethoxypyrimidin-5-yl)quinoline-3-sulfonamide |
| SMILES | CCCCOc1cc2c(Nc3cc(CO)cc(C4CCCC4)c3)c(S(N)(=O)=O)cnc2cc1-c1cnc(OC)nc1OC |
| InChI | InChI=1S/C31H37N5O6S/c1-4-5-10-42-27-15-24-26(14-23(27)25-16-34-31(41-3)36-30(25)40-2)33-17-28(43(32,38)39)29(24)35-22-12-19(18-37)11-21(13-22)20-8-6-7-9-20/h11-17,20,37H,4-10,18H2,1-3H3,(H,33,35)(H2,32,38,39) |
| InChIKey | YJTVODMVNKQGSU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 158.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.73 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|