C28H33N7O3S — CID 71610802
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[10-[2-(diethylamino)ethoxy]-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl]phenyl]urea (PubChem CID 71610802) has the molecular formula C28H33N7O3S and a molecular weight of 547.69 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[10-[2-(diethylamino)ethoxy]-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl]phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[10-[2-(diethylamino)ethoxy]-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl]phenyl]urea |
|---|---|
| PubChem CID | 71610802 |
| Molecular Formula | C28H33N7O3S |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[10-[2-(diethylamino)ethoxy]-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl]phenyl]urea |
| SMILES | CCN(CC)CCOc1ccc2c(n1)sc1nc(-c3ccc(NC(=O)Nc4cc(C(C)(C)C)on4)cc3)cn12 |
| InChI | InChI=1S/C28H33N7O3S/c1-6-34(7-2)14-15-37-24-13-12-21-25(32-24)39-27-30-20(17-35(21)27)18-8-10-19(11-9-18)29-26(36)31-23-16-22(38-33-23)28(3,4)5/h8-13,16-17H,6-7,14-15H2,1-5H3,(H2,29,31,33,36) |
| InChIKey | PVHWYDAHNDCNRZ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |