C39H46N6O8 — CID 71611680
N,N-dibutyl-1-[4-[(2,5-dimethoxy-3-nitrobenzoyl)amino]-2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]phenyl]-5-methylpyrazole-3-carboxamide (PubChem CID 71611680) has the molecular formula C39H46N6O8 and a molecular weight of 726.83 g/mol. Its IUPAC name is N,N-dibutyl-1-[4-[(2,5-dimethoxy-3-nitrobenzoyl)amino]-2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]phenyl]-5-methylpyrazole-3-carboxamide.
| Compound Name | N,N-dibutyl-1-[4-[(2,5-dimethoxy-3-nitrobenzoyl)amino]-2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]phenyl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 71611680 |
| Molecular Formula | C39H46N6O8 |
| Molecular Weight | 726.83 g/mol |
| Exact Mass | 726.34 |
| IUPAC Name | N,N-dibutyl-1-[4-[(2,5-dimethoxy-3-nitrobenzoyl)amino]-2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]phenyl]-5-methylpyrazole-3-carboxamide |
| SMILES | CCCCN(CCCC)C(=O)c1cc(C)n(-c2ccc(NC(=O)c3cc(OC)cc([N+](=O)[O-])c3OC)cc2C(=O)N2Cc3ccccc3C[C@H]2CO)n1 |
| InChI | InChI=1S/C39H46N6O8/c1-6-8-16-42(17-9-7-2)39(49)33-18-25(3)44(41-33)34-15-14-28(40-37(47)32-21-30(52-4)22-35(45(50)51)36(32)53-5)20-31(34)38(48)43-23-27-13-11-10-12-26(27)19-29(43)24-46/h10-15,18,20-22,29,46H,6-9,16-17,19,23-24H2,1-5H3,(H,40,47)/t29-/m0/s1 |
| InChIKey | HFZIUWJITDXOGB-LJAQVGFWSA-N |
| XLogP | 5.96 |
| TPSA | 169.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.83 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|