About Hydroxyzine monohydrochloride
Hydroxyzine monohydrochloride (PubChem CID 71612) has the molecular formula C21H28Cl2N2O2
and a molecular weight of 411.40 g/mol. Its IUPAC name is 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]ethanol;hydrochloride.
Molecular Properties
| Compound Name | Hydroxyzine monohydrochloride |
| PubChem CID | 71612 |
| Molecular Formula | C21H28Cl2N2O2 |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]ethanol;hydrochloride |
| SMILES | C1CN(CCN1CCOCCO)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl.Cl |
| InChI | InChI=1S/C21H27ClN2O2.ClH/c22-20-8-6-19(7-9-20)21(18-4-2-1-3-5-18)24-12-10-23(11-13-24)14-16-26-17-15-25;/h1-9,21,25H,10-17H2;1H |
| InChIKey | IPSVAUIEEPSJRZ-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 35.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | 376 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze Hydroxyzine monohydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Hydroxyzine monohydrochloride?
The IUPAC name of Hydroxyzine monohydrochloride (CID 71612) is 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]ethanol;hydrochloride.
What is the SMILES notation for Hydroxyzine monohydrochloride?
The canonical SMILES for Hydroxyzine monohydrochloride is C1CN(CCN1CCOCCO)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl.Cl.
What is the InChIKey of Hydroxyzine monohydrochloride?
The InChIKey is IPSVAUIEEPSJRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27ClN2O2.ClH/c22-20-8-6-19(7-9-20)21(18-4-2-1-3-5-18)24-12-10-23(11-13-24)14-16-26-17-15-25;/h1-9,21,25H,10-17H2;1H.
What are the key properties of Hydroxyzine monohydrochloride?
Hydroxyzine monohydrochloride has a molecular weight of 411.40 g/mol, XLogP of not available, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Hydroxyzine monohydrochloride is sourced from PubChem (CID 71612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).