C29H33N7O4S — CID 71612157
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[10-(3-morpholin-4-ylpropoxy)-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl]phenyl]urea (PubChem CID 71612157) has the molecular formula C29H33N7O4S and a molecular weight of 575.70 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[10-(3-morpholin-4-ylpropoxy)-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl]phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[10-(3-morpholin-4-ylpropoxy)-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl]phenyl]urea |
|---|---|
| PubChem CID | 71612157 |
| Molecular Formula | C29H33N7O4S |
| Molecular Weight | 575.70 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[10-(3-morpholin-4-ylpropoxy)-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl]phenyl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(-c3cn4c(n3)sc3nc(OCCCN5CCOCC5)ccc34)cc2)no1 |
| InChI | InChI=1S/C29H33N7O4S/c1-29(2,3)23-17-24(34-40-23)32-27(37)30-20-7-5-19(6-8-20)21-18-36-22-9-10-25(33-26(22)41-28(36)31-21)39-14-4-11-35-12-15-38-16-13-35/h5-10,17-18H,4,11-16H2,1-3H3,(H2,30,32,34,37) |
| InChIKey | OOEKHSNUUKIJRG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.70 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|