C28H32N8O3S — CID 71612524
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[10-(2-piperazin-1-ylethoxy)-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl]phenyl]urea (PubChem CID 71612524) has the molecular formula C28H32N8O3S and a molecular weight of 560.68 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[10-(2-piperazin-1-ylethoxy)-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl]phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[10-(2-piperazin-1-ylethoxy)-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl]phenyl]urea |
|---|---|
| PubChem CID | 71612524 |
| Molecular Formula | C28H32N8O3S |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[10-(2-piperazin-1-ylethoxy)-7-thia-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-4-yl]phenyl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(-c3cn4c(n3)sc3nc(OCCN5CCNCC5)ccc34)cc2)no1 |
| InChI | InChI=1S/C28H32N8O3S/c1-28(2,3)22-16-23(34-39-22)32-26(37)30-19-6-4-18(5-7-19)20-17-36-21-8-9-24(33-25(21)40-27(36)31-20)38-15-14-35-12-10-29-11-13-35/h4-9,16-17,29H,10-15H2,1-3H3,(H2,30,32,34,37) |
| InChIKey | ALKHXFRYGWAGTH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |