About 2-(hydroxymethyl)-2-[(4-nonoxyphenyl)methylamino]propane-1,3-diol;hydrochloride
2-(hydroxymethyl)-2-[(4-nonoxyphenyl)methylamino]propane-1,3-diol;hydrochloride (PubChem CID 71612669) has the molecular formula C20H36ClNO4
and a molecular weight of 389.96 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-[(4-nonoxyphenyl)methylamino]propane-1,3-diol;hydrochloride.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-2-[(4-nonoxyphenyl)methylamino]propane-1,3-diol;hydrochloride |
| PubChem CID | 71612669 |
| Molecular Formula | C20H36ClNO4 |
| Molecular Weight | 389.96 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 2-(hydroxymethyl)-2-[(4-nonoxyphenyl)methylamino]propane-1,3-diol;hydrochloride |
| SMILES | CCCCCCCCCOc1ccc(CNC(CO)(CO)CO)cc1.Cl |
| InChI | InChI=1S/C20H35NO4.ClH/c1-2-3-4-5-6-7-8-13-25-19-11-9-18(10-12-19)14-21-20(15-22,16-23)17-24;/h9-12,21-24H,2-8,13-17H2,1H3;1H |
| InChIKey | XFOJFXYOTLCKGT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.96 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethyl)-2-[(4-nonoxyphenyl)methylamino]propane-1,3-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-2-[(4-nonoxyphenyl)methylamino]propane-1,3-diol;hydrochloride?
The IUPAC name of 2-(hydroxymethyl)-2-[(4-nonoxyphenyl)methylamino]propane-1,3-diol;hydrochloride (CID 71612669) is 2-(hydroxymethyl)-2-[(4-nonoxyphenyl)methylamino]propane-1,3-diol;hydrochloride.
What is the SMILES notation for 2-(hydroxymethyl)-2-[(4-nonoxyphenyl)methylamino]propane-1,3-diol;hydrochloride?
The canonical SMILES for 2-(hydroxymethyl)-2-[(4-nonoxyphenyl)methylamino]propane-1,3-diol;hydrochloride is CCCCCCCCCOc1ccc(CNC(CO)(CO)CO)cc1.Cl.
What is the InChIKey of 2-(hydroxymethyl)-2-[(4-nonoxyphenyl)methylamino]propane-1,3-diol;hydrochloride?
The InChIKey is XFOJFXYOTLCKGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35NO4.ClH/c1-2-3-4-5-6-7-8-13-25-19-11-9-18(10-12-19)14-21-20(15-22,16-23)17-24;/h9-12,21-24H,2-8,13-17H2,1H3;1H.
What are the key properties of 2-(hydroxymethyl)-2-[(4-nonoxyphenyl)methylamino]propane-1,3-diol;hydrochloride?
2-(hydroxymethyl)-2-[(4-nonoxyphenyl)methylamino]propane-1,3-diol;hydrochloride has a molecular weight of 389.96 g/mol, XLogP of 3.04, 15 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-2-[(4-nonoxyphenyl)methylamino]propane-1,3-diol;hydrochloride is sourced from PubChem (CID 71612669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).