C25H19F3O5 — CID 71612682
2-[(8S)-3-[3-[2-(trifluoromethyl)phenyl]phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid (PubChem CID 71612682) has the molecular formula C25H19F3O5 and a molecular weight of 456.42 g/mol. Its IUPAC name is 2-[(8S)-3-[3-[2-(trifluoromethyl)phenyl]phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid.
| Compound Name | 2-[(8S)-3-[3-[2-(trifluoromethyl)phenyl]phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid |
|---|---|
| PubChem CID | 71612682 |
| Molecular Formula | C25H19F3O5 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 2-[(8S)-3-[3-[2-(trifluoromethyl)phenyl]phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1COc2cc3c(cc21)OCC(c1cccc(-c2ccccc2C(F)(F)F)c1)O3 |
| InChI | InChI=1S/C25H19F3O5/c26-25(27,28)19-7-2-1-6-17(19)14-4-3-5-15(8-14)23-13-32-21-10-18-16(9-24(29)30)12-31-20(18)11-22(21)33-23/h1-8,10-11,16,23H,9,12-13H2,(H,29,30)/t16-,23?/m1/s1 |
| InChIKey | AIBXCIUCHSLECL-ADRQNKRLSA-N |
| XLogP | 5.84 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |