C27H32N4O4S — CID 71612695
benzyl N-[(2S)-1-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-1-oxo-3-(4-thiophen-2-ylphenyl)propan-2-yl]carbamate (PubChem CID 71612695) has the molecular formula C27H32N4O4S and a molecular weight of 508.64 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-1-oxo-3-(4-thiophen-2-ylphenyl)propan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-1-oxo-3-(4-thiophen-2-ylphenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 71612695 |
| Molecular Formula | C27H32N4O4S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | benzyl N-[(2S)-1-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-1-oxo-3-(4-thiophen-2-ylphenyl)propan-2-yl]carbamate |
| SMILES | NCCCC[C@H](NC(=O)[C@H](Cc1ccc(-c2cccs2)cc1)NC(=O)OCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C27H32N4O4S/c28-15-5-4-9-22(25(29)32)30-26(33)23(31-27(34)35-18-20-7-2-1-3-8-20)17-19-11-13-21(14-12-19)24-10-6-16-36-24/h1-3,6-8,10-14,16,22-23H,4-5,9,15,17-18,28H2,(H2,29,32)(H,30,33)(H,31,34)/t22-,23-/m0/s1 |
| InChIKey | QVSGVZXBAFKBMA-GOTSBHOMSA-N |
| XLogP | 3.35 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|