C14H23N5OS — CID 71612774
3,11-dipropyl-6-sulfanylidene-1,3,5,7,11-pentazatricyclo[7.3.1.05,13]tridec-9(13)-en-8-one (PubChem CID 71612774) has the molecular formula C14H23N5OS and a molecular weight of 309.44 g/mol. Its IUPAC name is 3,11-dipropyl-6-sulfanylidene-1,3,5,7,11-pentazatricyclo[7.3.1.05,13]tridec-9(13)-en-8-one.
| Compound Name | 3,11-dipropyl-6-sulfanylidene-1,3,5,7,11-pentazatricyclo[7.3.1.05,13]tridec-9(13)-en-8-one |
|---|---|
| PubChem CID | 71612774 |
| Molecular Formula | C14H23N5OS |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 3,11-dipropyl-6-sulfanylidene-1,3,5,7,11-pentazatricyclo[7.3.1.05,13]tridec-9(13)-en-8-one |
| SMILES | CCCN1Cc2c3n(c(=S)[nH]c2=O)CN(CCC)CN3C1 |
| InChI | InChI=1S/C14H23N5OS/c1-3-5-16-7-11-12(20)15-14(21)19-10-17(6-4-2)9-18(8-16)13(11)19/h3-10H2,1-2H3,(H,15,20,21) |
| InChIKey | ZIXGWUDKPDQYHB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 47.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|