C25H44O3Si2 — CID 71612810
(2R,3R)-3-[[2,6-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]methyl]-2-methylpent-4-yn-1-ol (PubChem CID 71612810) has the molecular formula C25H44O3Si2 and a molecular weight of 448.80 g/mol. Its IUPAC name is (2R,3R)-3-[[2,6-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]methyl]-2-methylpent-4-yn-1-ol.
| Compound Name | (2R,3R)-3-[[2,6-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]methyl]-2-methylpent-4-yn-1-ol |
|---|---|
| PubChem CID | 71612810 |
| Molecular Formula | C25H44O3Si2 |
| Molecular Weight | 448.80 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | (2R,3R)-3-[[2,6-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]methyl]-2-methylpent-4-yn-1-ol |
| SMILES | C#C[C@H](Cc1c(O[Si](C)(C)C(C)(C)C)cccc1O[Si](C)(C)C(C)(C)C)[C@@H](C)CO |
| InChI | InChI=1S/C25H44O3Si2/c1-13-20(19(2)18-26)17-21-22(27-29(9,10)24(3,4)5)15-14-16-23(21)28-30(11,12)25(6,7)8/h1,14-16,19-20,26H,17-18H2,2-12H3/t19-,20+/m0/s1 |
| InChIKey | MILKWEKFSRAXNO-VQTJNVASSA-N |
| XLogP | 6.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.80 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|