C19H14F4O5 — CID 71612895
2-[(8S)-3-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid (PubChem CID 71612895) has the molecular formula C19H14F4O5 and a molecular weight of 398.31 g/mol. Its IUPAC name is 2-[(8S)-3-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid.
| Compound Name | 2-[(8S)-3-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid |
|---|---|
| PubChem CID | 71612895 |
| Molecular Formula | C19H14F4O5 |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 2-[(8S)-3-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1COc2cc3c(cc21)OCC(c1cc(F)cc(C(F)(F)F)c1)O3 |
| InChI | InChI=1S/C19H14F4O5/c20-12-2-9(1-11(4-12)19(21,22)23)17-8-27-15-5-13-10(3-18(24)25)7-26-14(13)6-16(15)28-17/h1-2,4-6,10,17H,3,7-8H2,(H,24,25)/t10-,17?/m1/s1 |
| InChIKey | XAQXWFCNNIEQMY-YQDUUYOCSA-N |
| XLogP | 4.31 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |