C30H32O8S — CID 71612897
2-[(3S,8S)-3-[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid (PubChem CID 71612897) has the molecular formula C30H32O8S and a molecular weight of 552.65 g/mol. Its IUPAC name is 2-[(3S,8S)-3-[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid.
| Compound Name | 2-[(3S,8S)-3-[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid |
|---|---|
| PubChem CID | 71612897 |
| Molecular Formula | C30H32O8S |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 2-[(3S,8S)-3-[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid |
| SMILES | Cc1cc(OCCCS(C)(=O)=O)cc(C)c1-c1cccc([C@H]2COc3cc4c(cc3O2)OC[C@H]4CC(=O)O)c1 |
| InChI | InChI=1S/C30H32O8S/c1-18-10-23(35-8-5-9-39(3,33)34)11-19(2)30(18)21-7-4-6-20(12-21)28-17-37-26-14-24-22(13-29(31)32)16-36-25(24)15-27(26)38-28/h4,6-7,10-12,14-15,22,28H,5,8-9,13,16-17H2,1-3H3,(H,31,32)/t22-,28-/m1/s1 |
| InChIKey | JKYVMOIZUKBTDA-SKCUWOTOSA-N |
| XLogP | 5.25 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|