C27H20F7N3O3S — CID 71612933
N-[4-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]thiophen-2-yl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide (PubChem CID 71612933) has the molecular formula C27H20F7N3O3S and a molecular weight of 599.53 g/mol. Its IUPAC name is N-[4-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]thiophen-2-yl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[4-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]thiophen-2-yl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 71612933 |
| Molecular Formula | C27H20F7N3O3S |
| Molecular Weight | 599.53 g/mol |
| Exact Mass | 599.11 |
| IUPAC Name | N-[4-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]thiophen-2-yl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1csc(NC(=O)c2c(-c3ccccc3)noc2C)c1 |
| InChI | InChI=1S/C27H20F7N3O3S/c1-13-9-18(25(28,26(29,30)31)27(32,33)34)10-14(2)21(13)36-23(38)17-11-19(41-12-17)35-24(39)20-15(3)40-37-22(20)16-7-5-4-6-8-16/h4-12H,1-3H3,(H,35,39)(H,36,38) |
| InChIKey | GNWZISRSCKOWCK-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.53 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |