C27H45NO4Si — CID 71612944
(1R)-1-[(4R,5S)-5-[(1S)-1-[benzyl(prop-2-enyl)amino]but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol (PubChem CID 71612944) has the molecular formula C27H45NO4Si and a molecular weight of 475.75 g/mol. Its IUPAC name is (1R)-1-[(4R,5S)-5-[(1S)-1-[benzyl(prop-2-enyl)amino]but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol.
| Compound Name | (1R)-1-[(4R,5S)-5-[(1S)-1-[benzyl(prop-2-enyl)amino]but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol |
|---|---|
| PubChem CID | 71612944 |
| Molecular Formula | C27H45NO4Si |
| Molecular Weight | 475.75 g/mol |
| Exact Mass | 475.31 |
| IUPAC Name | (1R)-1-[(4R,5S)-5-[(1S)-1-[benzyl(prop-2-enyl)amino]but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol |
| SMILES | C=CC[C@@H]([C@@H]1OC(C)(C)O[C@@H]1[C@H](O)CO[Si](C)(C)C(C)(C)C)N(CC=C)Cc1ccccc1 |
| InChI | InChI=1S/C27H45NO4Si/c1-10-15-22(28(18-11-2)19-21-16-13-12-14-17-21)24-25(32-27(6,7)31-24)23(29)20-30-33(8,9)26(3,4)5/h10-14,16-17,22-25,29H,1-2,15,18-20H2,3-9H3/t22-,23+,24-,25+/m0/s1 |
| InChIKey | YMWLICDUZRCYDE-FQUZAXHOSA-N |
| XLogP | 5.52 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.75 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|