About 2-(2-methoxyethoxy)ethyl 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]indazole-1-carboxylate
2-(2-methoxyethoxy)ethyl 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]indazole-1-carboxylate (PubChem CID 71613310) has the molecular formula C22H21ClN4O5
and a molecular weight of 456.89 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]indazole-1-carboxylate.
Molecular Properties
| Compound Name | 2-(2-methoxyethoxy)ethyl 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]indazole-1-carboxylate |
| PubChem CID | 71613310 |
| Molecular Formula | C22H21ClN4O5 |
| Molecular Weight | 456.89 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]indazole-1-carboxylate |
| SMILES | COCCOCCOC(=O)n1ncc2cc(Nc3ncc(-c4ccc(Cl)cc4)o3)ccc21 |
| InChI | InChI=1S/C22H21ClN4O5/c1-29-8-9-30-10-11-31-22(28)27-19-7-6-18(12-16(19)13-25-27)26-21-24-14-20(32-21)15-2-4-17(23)5-3-15/h2-7,12-14H,8-11H2,1H3,(H,24,26) |
| InChIKey | IMYFURZBDJXEFA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.89 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxyethoxy)ethyl 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]indazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyethoxy)ethyl 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]indazole-1-carboxylate?
The IUPAC name of 2-(2-methoxyethoxy)ethyl 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]indazole-1-carboxylate (CID 71613310) is 2-(2-methoxyethoxy)ethyl 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]indazole-1-carboxylate.
What is the SMILES notation for 2-(2-methoxyethoxy)ethyl 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]indazole-1-carboxylate?
The canonical SMILES for 2-(2-methoxyethoxy)ethyl 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]indazole-1-carboxylate is COCCOCCOC(=O)n1ncc2cc(Nc3ncc(-c4ccc(Cl)cc4)o3)ccc21.
What is the InChIKey of 2-(2-methoxyethoxy)ethyl 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]indazole-1-carboxylate?
The InChIKey is IMYFURZBDJXEFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21ClN4O5/c1-29-8-9-30-10-11-31-22(28)27-19-7-6-18(12-16(19)13-25-27)26-21-24-14-20(32-21)15-2-4-17(23)5-3-15/h2-7,12-14H,8-11H2,1H3,(H,24,26).
What are the key properties of 2-(2-methoxyethoxy)ethyl 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]indazole-1-carboxylate?
2-(2-methoxyethoxy)ethyl 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]indazole-1-carboxylate has a molecular weight of 456.89 g/mol, XLogP of 4.74, 9 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethoxy)ethyl 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]indazole-1-carboxylate is sourced from PubChem (CID 71613310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).