C20H20N2O5S — CID 71613433
(2S,3R)-3-[1-(benzenesulfonyl)indol-3-yl]-2-ethyl-4-nitrobutanal (PubChem CID 71613433) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is (2S,3R)-3-[1-(benzenesulfonyl)indol-3-yl]-2-ethyl-4-nitrobutanal.
| Compound Name | (2S,3R)-3-[1-(benzenesulfonyl)indol-3-yl]-2-ethyl-4-nitrobutanal |
|---|---|
| PubChem CID | 71613433 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | (2S,3R)-3-[1-(benzenesulfonyl)indol-3-yl]-2-ethyl-4-nitrobutanal |
| SMILES | CC[C@H](C=O)[C@@H](C[N+](=O)[O-])c1cn(S(=O)(=O)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C20H20N2O5S/c1-2-15(14-23)18(13-22(24)25)19-12-21(20-11-7-6-10-17(19)20)28(26,27)16-8-4-3-5-9-16/h3-12,14-15,18H,2,13H2,1H3/t15-,18-/m1/s1 |
| InChIKey | ZJLTWEZAQNXFCG-CRAIPNDOSA-N |
| XLogP | 3.46 |
| TPSA | 99.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|