C19H15F3O5 — CID 71613520
2-[(3R,8S)-3-[3-(trifluoromethyl)phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid (PubChem CID 71613520) has the molecular formula C19H15F3O5 and a molecular weight of 380.32 g/mol. Its IUPAC name is 2-[(3R,8S)-3-[3-(trifluoromethyl)phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid.
| Compound Name | 2-[(3R,8S)-3-[3-(trifluoromethyl)phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid |
|---|---|
| PubChem CID | 71613520 |
| Molecular Formula | C19H15F3O5 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 2-[(3R,8S)-3-[3-(trifluoromethyl)phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1COc2cc3c(cc21)OC[C@@H](c1cccc(C(F)(F)F)c1)O3 |
| InChI | InChI=1S/C19H15F3O5/c20-19(21,22)12-3-1-2-10(4-12)17-9-26-15-6-13-11(5-18(23)24)8-25-14(13)7-16(15)27-17/h1-4,6-7,11,17H,5,8-9H2,(H,23,24)/t11-,17+/m1/s1 |
| InChIKey | HOQSHGDIZLASFK-DIFFPNOSSA-N |
| XLogP | 4.17 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |