C15H18O3 — CID 71613571
(3S,3aS,6aR,9aR,9bS)-3-methyl-6,9-dimethylidene-3,3a,4,5,6a,7,9a,9b-octahydroazuleno[4,5-b]furan-2,8-dione (PubChem CID 71613571) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (3S,3aS,6aR,9aR,9bS)-3-methyl-6,9-dimethylidene-3,3a,4,5,6a,7,9a,9b-octahydroazuleno[4,5-b]furan-2,8-dione.
| Compound Name | (3S,3aS,6aR,9aR,9bS)-3-methyl-6,9-dimethylidene-3,3a,4,5,6a,7,9a,9b-octahydroazuleno[4,5-b]furan-2,8-dione |
|---|---|
| PubChem CID | 71613571 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (3S,3aS,6aR,9aR,9bS)-3-methyl-6,9-dimethylidene-3,3a,4,5,6a,7,9a,9b-octahydroazuleno[4,5-b]furan-2,8-dione |
| SMILES | C=C1C(=O)C[C@H]2C(=C)CC[C@@H]3[C@H](OC(=O)[C@H]3C)[C@@H]12 |
| InChI | InChI=1S/C15H18O3/c1-7-4-5-10-8(2)15(17)18-14(10)13-9(3)12(16)6-11(7)13/h8,10-11,13-14H,1,3-6H2,2H3/t8-,10-,11-,13-,14-/m0/s1 |
| InChIKey | HFEIGOVBMFYQTI-WUGNMRFOSA-N |
| XLogP | 2.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|