About [(E)-3-[(2S,3R)-3-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate
[(E)-3-[(2S,3R)-3-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate (PubChem CID 71613638) has the molecular formula C10H14O5
and a molecular weight of 214.22 g/mol. Its IUPAC name is [(E)-3-[(2S,3R)-3-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate.
Molecular Properties
| Compound Name | [(E)-3-[(2S,3R)-3-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate |
| PubChem CID | 71613638 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | [(E)-3-[(2S,3R)-3-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C/[C@@H]1O[C@H]1[C@@H]1O[C@H]1CO |
| InChI | InChI=1S/C10H14O5/c1-6(12)13-4-2-3-7-9(14-7)10-8(5-11)15-10/h2-3,7-11H,4-5H2,1H3/b3-2+/t7-,8-,9+,10+/m0/s1 |
| InChIKey | IGOMLLHDTGFRIM-LGWNHXHGSA-N |
| XLogP | -0.37 |
| TPSA | 71.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3-[(2S,3R)-3-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-[(2S,3R)-3-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate?
The IUPAC name of [(E)-3-[(2S,3R)-3-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate (CID 71613638) is [(E)-3-[(2S,3R)-3-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate.
What is the SMILES notation for [(E)-3-[(2S,3R)-3-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate?
The canonical SMILES for [(E)-3-[(2S,3R)-3-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate is CC(=O)OC/C=C/[C@@H]1O[C@H]1[C@@H]1O[C@H]1CO.
What is the InChIKey of [(E)-3-[(2S,3R)-3-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate?
The InChIKey is IGOMLLHDTGFRIM-LGWNHXHGSA-N. The full InChI is InChI=1S/C10H14O5/c1-6(12)13-4-2-3-7-9(14-7)10-8(5-11)15-10/h2-3,7-11H,4-5H2,1H3/b3-2+/t7-,8-,9+,10+/m0/s1.
What are the key properties of [(E)-3-[(2S,3R)-3-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate?
[(E)-3-[(2S,3R)-3-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate has a molecular weight of 214.22 g/mol, XLogP of -0.37, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-[(2S,3R)-3-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate is sourced from PubChem (CID 71613638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).