C27H34O10 — CID 71613711
5-O-[(2S,4aR,6aR,7R,9S,10aS,10bR)-2-(furan-3-yl)-7-methoxycarbonyl-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromen-9-yl] 1-O-methyl pentanedioate (PubChem CID 71613711) has the molecular formula C27H34O10 and a molecular weight of 518.56 g/mol. Its IUPAC name is 5-O-[(2S,4aR,6aR,7R,9S,10aS,10bR)-2-(furan-3-yl)-7-methoxycarbonyl-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromen-9-yl] 1-O-methyl pentanedioate.
| Compound Name | 5-O-[(2S,4aR,6aR,7R,9S,10aS,10bR)-2-(furan-3-yl)-7-methoxycarbonyl-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromen-9-yl] 1-O-methyl pentanedioate |
|---|---|
| PubChem CID | 71613711 |
| Molecular Formula | C27H34O10 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 5-O-[(2S,4aR,6aR,7R,9S,10aS,10bR)-2-(furan-3-yl)-7-methoxycarbonyl-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromen-9-yl] 1-O-methyl pentanedioate |
| SMILES | COC(=O)CCCC(=O)O[C@H]1C[C@@H](C(=O)OC)[C@]2(C)CC[C@H]3C(=O)O[C@H](c4ccoc4)C[C@]3(C)[C@H]2C1=O |
| InChI | InChI=1S/C27H34O10/c1-26-10-8-16-25(32)37-19(15-9-11-35-14-15)13-27(16,2)23(26)22(30)18(12-17(26)24(31)34-4)36-21(29)7-5-6-20(28)33-3/h9,11,14,16-19,23H,5-8,10,12-13H2,1-4H3/t16-,17-,18-,19-,23-,26-,27-/m0/s1 |
| InChIKey | GJIPUOVMCCRVJQ-HYVGBNOBSA-N |
| XLogP | 3.32 |
| TPSA | 135.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|