C29H33F2N5O6 — CID 71613727
tert-butyl 4-[1-ethyl-6,8-difluoro-3-[(4-methyl-3-nitrophenyl)carbamoyl]-4-oxoquinolin-7-yl]-2-methylpiperazine-1-carboxylate (PubChem CID 71613727) has the molecular formula C29H33F2N5O6 and a molecular weight of 585.61 g/mol. Its IUPAC name is tert-butyl 4-[1-ethyl-6,8-difluoro-3-[(4-methyl-3-nitrophenyl)carbamoyl]-4-oxoquinolin-7-yl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-ethyl-6,8-difluoro-3-[(4-methyl-3-nitrophenyl)carbamoyl]-4-oxoquinolin-7-yl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 71613727 |
| Molecular Formula | C29H33F2N5O6 |
| Molecular Weight | 585.61 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | tert-butyl 4-[1-ethyl-6,8-difluoro-3-[(4-methyl-3-nitrophenyl)carbamoyl]-4-oxoquinolin-7-yl]-2-methylpiperazine-1-carboxylate |
| SMILES | CCn1cc(C(=O)Nc2ccc(C)c([N+](=O)[O-])c2)c(=O)c2cc(F)c(N3CCN(C(=O)OC(C)(C)C)C(C)C3)c(F)c21 |
| InChI | InChI=1S/C29H33F2N5O6/c1-7-33-15-20(27(38)32-18-9-8-16(2)22(12-18)36(40)41)26(37)19-13-21(30)25(23(31)24(19)33)34-10-11-35(17(3)14-34)28(39)42-29(4,5)6/h8-9,12-13,15,17H,7,10-11,14H2,1-6H3,(H,32,38) |
| InChIKey | DXKLWKGQYXQHFD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 127.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|