About 3-(4-methoxyphenyl)-1,2-diphenyl-5-(trifluoromethyl)inden-1-ol
3-(4-methoxyphenyl)-1,2-diphenyl-5-(trifluoromethyl)inden-1-ol (PubChem CID 71613772) has the molecular formula C29H21F3O2
and a molecular weight of 458.48 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1,2-diphenyl-5-(trifluoromethyl)inden-1-ol.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)-1,2-diphenyl-5-(trifluoromethyl)inden-1-ol |
| PubChem CID | 71613772 |
| Molecular Formula | C29H21F3O2 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 3-(4-methoxyphenyl)-1,2-diphenyl-5-(trifluoromethyl)inden-1-ol |
| SMILES | COc1ccc(C2=C(c3ccccc3)C(O)(c3ccccc3)c3ccc(C(F)(F)F)cc32)cc1 |
| InChI | InChI=1S/C29H21F3O2/c1-34-23-15-12-19(13-16-23)26-24-18-22(29(30,31)32)14-17-25(24)28(33,21-10-6-3-7-11-21)27(26)20-8-4-2-5-9-20/h2-18,33H,1H3 |
| InChIKey | KTBWLBXENYYVGE-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-methoxyphenyl)-1,2-diphenyl-5-(trifluoromethyl)inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)-1,2-diphenyl-5-(trifluoromethyl)inden-1-ol?
The IUPAC name of 3-(4-methoxyphenyl)-1,2-diphenyl-5-(trifluoromethyl)inden-1-ol (CID 71613772) is 3-(4-methoxyphenyl)-1,2-diphenyl-5-(trifluoromethyl)inden-1-ol.
What is the SMILES notation for 3-(4-methoxyphenyl)-1,2-diphenyl-5-(trifluoromethyl)inden-1-ol?
The canonical SMILES for 3-(4-methoxyphenyl)-1,2-diphenyl-5-(trifluoromethyl)inden-1-ol is COc1ccc(C2=C(c3ccccc3)C(O)(c3ccccc3)c3ccc(C(F)(F)F)cc32)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)-1,2-diphenyl-5-(trifluoromethyl)inden-1-ol?
The InChIKey is KTBWLBXENYYVGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H21F3O2/c1-34-23-15-12-19(13-16-23)26-24-18-22(29(30,31)32)14-17-25(24)28(33,21-10-6-3-7-11-21)27(26)20-8-4-2-5-9-20/h2-18,33H,1H3.
What are the key properties of 3-(4-methoxyphenyl)-1,2-diphenyl-5-(trifluoromethyl)inden-1-ol?
3-(4-methoxyphenyl)-1,2-diphenyl-5-(trifluoromethyl)inden-1-ol has a molecular weight of 458.48 g/mol, XLogP of 6.92, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)-1,2-diphenyl-5-(trifluoromethyl)inden-1-ol is sourced from PubChem (CID 71613772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).