C19H26BrN5 — CID 71613777
(12R,14R,15S)-1-benzyl-4,8,11-triaza-1-azoniatetracyclo[6.5.2.04,15.011,14]pentadecane-12-carbonitrile bromide (PubChem CID 71613777) has the molecular formula C19H26BrN5 and a molecular weight of 404.36 g/mol. Its IUPAC name is (12R,14R,15S)-1-benzyl-4,8,11-triaza-1-azoniatetracyclo[6.5.2.04,15.011,14]pentadecane-12-carbonitrile bromide.
| Compound Name | (12R,14R,15S)-1-benzyl-4,8,11-triaza-1-azoniatetracyclo[6.5.2.04,15.011,14]pentadecane-12-carbonitrile bromide |
|---|---|
| PubChem CID | 71613777 |
| Molecular Formula | C19H26BrN5 |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | (12R,14R,15S)-1-benzyl-4,8,11-triaza-1-azoniatetracyclo[6.5.2.04,15.011,14]pentadecane-12-carbonitrile bromide |
| SMILES | N#C[C@H]1C[N+]2(Cc3ccccc3)CCN3CCCN4CCN1[C@H]2[C@@H]43.[Br-] |
| InChI | InChI=1S/C19H26N5.BrH/c20-13-17-15-24(14-16-5-2-1-3-6-16)12-11-22-8-4-7-21-9-10-23(17)19(24)18(21)22;/h1-3,5-6,17-19H,4,7-12,14-15H2;1H/q+1;/p-1/t17-,18-,19+,24?;/m0./s1 |
| InChIKey | RIKFGJAKSZPHCX-NTXBQVDLSA-M |
| XLogP | -2.10 |
| TPSA | 33.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|