C18H26N2O2 — CID 71613876
(3S,4aR,8aR)-3-(5-tert-butyl-2-hydroxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-one (PubChem CID 71613876) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is (3S,4aR,8aR)-3-(5-tert-butyl-2-hydroxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-one.
| Compound Name | (3S,4aR,8aR)-3-(5-tert-butyl-2-hydroxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 71613876 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (3S,4aR,8aR)-3-(5-tert-butyl-2-hydroxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-one |
| SMILES | CC(C)(C)c1ccc(O)c([C@@H]2N[C@@H]3CCCC[C@H]3NC2=O)c1 |
| InChI | InChI=1S/C18H26N2O2/c1-18(2,3)11-8-9-15(21)12(10-11)16-17(22)20-14-7-5-4-6-13(14)19-16/h8-10,13-14,16,19,21H,4-7H2,1-3H3,(H,20,22)/t13-,14-,16+/m1/s1 |
| InChIKey | JTPMNRQWUVSDRS-FMKPAKJESA-N |
| XLogP | 2.76 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|