C27H32O10 — CID 71613906
4-O-[(2S,4aR,6aR,7R,9S,10aS,10bR)-2-(furan-3-yl)-7-methoxycarbonyl-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromen-9-yl] 1-O-ethyl (E)-but-2-enedioate (PubChem CID 71613906) has the molecular formula C27H32O10 and a molecular weight of 516.54 g/mol. Its IUPAC name is 4-O-[(2S,4aR,6aR,7R,9S,10aS,10bR)-2-(furan-3-yl)-7-methoxycarbonyl-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromen-9-yl] 1-O-ethyl (E)-but-2-enedioate.
| Compound Name | 4-O-[(2S,4aR,6aR,7R,9S,10aS,10bR)-2-(furan-3-yl)-7-methoxycarbonyl-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromen-9-yl] 1-O-ethyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 71613906 |
| Molecular Formula | C27H32O10 |
| Molecular Weight | 516.54 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 4-O-[(2S,4aR,6aR,7R,9S,10aS,10bR)-2-(furan-3-yl)-7-methoxycarbonyl-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromen-9-yl] 1-O-ethyl (E)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(=O)O[C@H]1C[C@@H](C(=O)OC)[C@]2(C)CC[C@H]3C(=O)O[C@H](c4ccoc4)C[C@]3(C)[C@H]2C1=O |
| InChI | InChI=1S/C27H32O10/c1-5-35-20(28)6-7-21(29)36-18-12-17(24(31)33-4)26(2)10-8-16-25(32)37-19(15-9-11-34-14-15)13-27(16,3)23(26)22(18)30/h6-7,9,11,14,16-19,23H,5,8,10,12-13H2,1-4H3/b7-6+/t16-,17-,18-,19-,23-,26-,27-/m0/s1 |
| InChIKey | CTSSWDVKQDLESR-QUIMUEFNSA-N |
| XLogP | 3.10 |
| TPSA | 135.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|