C23H20N2O2 — CID 71614056
4-(2,4-dimethoxyphenyl)-1,2-diphenylimidazole (PubChem CID 71614056) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-1,2-diphenylimidazole.
| Compound Name | 4-(2,4-dimethoxyphenyl)-1,2-diphenylimidazole |
|---|---|
| PubChem CID | 71614056 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-1,2-diphenylimidazole |
| SMILES | COc1ccc(-c2cn(-c3ccccc3)c(-c3ccccc3)n2)c(OC)c1 |
| InChI | InChI=1S/C23H20N2O2/c1-26-19-13-14-20(22(15-19)27-2)21-16-25(18-11-7-4-8-12-18)23(24-21)17-9-5-3-6-10-17/h3-16H,1-2H3 |
| InChIKey | HRTSTWBIPFZOQC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |