C35H35FO5 — CID 71614059
(2E,3R,4S,5R,6R)-2-(fluoromethylidene)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 71614059) has the molecular formula C35H35FO5 and a molecular weight of 554.66 g/mol. Its IUPAC name is (2E,3R,4S,5R,6R)-2-(fluoromethylidene)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2E,3R,4S,5R,6R)-2-(fluoromethylidene)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 71614059 |
| Molecular Formula | C35H35FO5 |
| Molecular Weight | 554.66 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | (2E,3R,4S,5R,6R)-2-(fluoromethylidene)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | F/C=C1/O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H35FO5/c36-21-31-33(38-23-28-15-7-2-8-16-28)35(40-25-30-19-11-4-12-20-30)34(39-24-29-17-9-3-10-18-29)32(41-31)26-37-22-27-13-5-1-6-14-27/h1-21,32-35H,22-26H2/b31-21+/t32-,33+,34-,35-/m1/s1 |
| InChIKey | CGIKHTYFQLYNAH-IXUGOTAKSA-N |
| XLogP | 7.17 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.66 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |