C20H18N2O4 — CID 71614079
(18R,19S)-19-ethyl-18,19-dihydroxy-16-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-14-one (PubChem CID 71614079) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is (18R,19S)-19-ethyl-18,19-dihydroxy-16-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-14-one.
| Compound Name | (18R,19S)-19-ethyl-18,19-dihydroxy-16-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-14-one |
|---|---|
| PubChem CID | 71614079 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (18R,19S)-19-ethyl-18,19-dihydroxy-16-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-14-one |
| SMILES | CC[C@]1(O)c2cc3n(c(=O)c2OC[C@H]1O)Cc1cc2ccccc2nc1-3 |
| InChI | InChI=1S/C20H18N2O4/c1-2-20(25)13-8-15-17-12(7-11-5-3-4-6-14(11)21-17)9-22(15)19(24)18(13)26-10-16(20)23/h3-8,16,23,25H,2,9-10H2,1H3/t16-,20+/m1/s1 |
| InChIKey | BQCCBWCQVUESHO-UZLBHIALSA-N |
| XLogP | 1.78 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |