C13H15NO3 — CID 71614179
(4S,7R,8aS)-7-hydroxy-4-phenyl-1,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-3-one (PubChem CID 71614179) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is (4S,7R,8aS)-7-hydroxy-4-phenyl-1,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-3-one.
| Compound Name | (4S,7R,8aS)-7-hydroxy-4-phenyl-1,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 71614179 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (4S,7R,8aS)-7-hydroxy-4-phenyl-1,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-3-one |
| SMILES | O=C1OC[C@@H]2C[C@@H](O)CN2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C13H15NO3/c15-11-6-10-8-17-13(16)12(14(10)7-11)9-4-2-1-3-5-9/h1-5,10-12,15H,6-8H2/t10-,11+,12-/m0/s1 |
| InChIKey | XVMVNRPTPNUPIV-TUAOUCFPSA-N |
| XLogP | 0.72 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |