About (5R)-5-[(E)-but-2-enoxy]-2-methylnona-1,8-dien-3-yne
(5R)-5-[(E)-but-2-enoxy]-2-methylnona-1,8-dien-3-yne (PubChem CID 71614408) has the molecular formula C14H20O
and a molecular weight of 204.31 g/mol. Its IUPAC name is (5R)-5-[(E)-but-2-enoxy]-2-methylnona-1,8-dien-3-yne.
Molecular Properties
| Compound Name | (5R)-5-[(E)-but-2-enoxy]-2-methylnona-1,8-dien-3-yne |
| PubChem CID | 71614408 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (5R)-5-[(E)-but-2-enoxy]-2-methylnona-1,8-dien-3-yne |
| SMILES | C=CCC[C@H](C#CC(=C)C)OC/C=C/C |
| InChI | InChI=1S/C14H20O/c1-5-7-9-14(11-10-13(3)4)15-12-8-6-2/h5-6,8,14H,1,3,7,9,12H2,2,4H3/b8-6+/t14-/m1/s1 |
| InChIKey | MWTOSFXHQYNTOE-IZPAUZPXSA-N |
| XLogP | 3.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-[(E)-but-2-enoxy]-2-methylnona-1,8-dien-3-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-[(E)-but-2-enoxy]-2-methylnona-1,8-dien-3-yne?
The IUPAC name of (5R)-5-[(E)-but-2-enoxy]-2-methylnona-1,8-dien-3-yne (CID 71614408) is (5R)-5-[(E)-but-2-enoxy]-2-methylnona-1,8-dien-3-yne.
What is the SMILES notation for (5R)-5-[(E)-but-2-enoxy]-2-methylnona-1,8-dien-3-yne?
The canonical SMILES for (5R)-5-[(E)-but-2-enoxy]-2-methylnona-1,8-dien-3-yne is C=CCC[C@H](C#CC(=C)C)OC/C=C/C.
What is the InChIKey of (5R)-5-[(E)-but-2-enoxy]-2-methylnona-1,8-dien-3-yne?
The InChIKey is MWTOSFXHQYNTOE-IZPAUZPXSA-N. The full InChI is InChI=1S/C14H20O/c1-5-7-9-14(11-10-13(3)4)15-12-8-6-2/h5-6,8,14H,1,3,7,9,12H2,2,4H3/b8-6+/t14-/m1/s1.
What are the key properties of (5R)-5-[(E)-but-2-enoxy]-2-methylnona-1,8-dien-3-yne?
(5R)-5-[(E)-but-2-enoxy]-2-methylnona-1,8-dien-3-yne has a molecular weight of 204.31 g/mol, XLogP of 3.49, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-[(E)-but-2-enoxy]-2-methylnona-1,8-dien-3-yne is sourced from PubChem (CID 71614408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).