C25H42N2O5Si2 — CID 71614437
6-amino-4-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]isoindole-1,3-dione (PubChem CID 71614437) has the molecular formula C25H42N2O5Si2 and a molecular weight of 506.79 g/mol. Its IUPAC name is 6-amino-4-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]isoindole-1,3-dione.
| Compound Name | 6-amino-4-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 71614437 |
| Molecular Formula | C25H42N2O5Si2 |
| Molecular Weight | 506.79 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 6-amino-4-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]isoindole-1,3-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](c2cc(N)cc3c2C(=O)NC3=O)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H42N2O5Si2/c1-24(2,3)33(7,8)30-14-20-19(32-34(9,10)25(4,5)6)13-18(31-20)16-11-15(26)12-17-21(16)23(29)27-22(17)28/h11-12,18-20H,13-14,26H2,1-10H3,(H,27,28,29)/t18-,19+,20-/m1/s1 |
| InChIKey | BFYUQTSYODKZAN-HSALFYBXSA-N |
| XLogP | 5.39 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.79 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|