C12H16ClNO5 — CID 7161460
(2R,3R,4R,5S,6S)-2-(4-chloroanilino)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 7161460) has the molecular formula C12H16ClNO5 and a molecular weight of 289.72 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-2-(4-chloroanilino)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S,6S)-2-(4-chloroanilino)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 7161460 |
| Molecular Formula | C12H16ClNO5 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | (2R,3R,4R,5S,6S)-2-(4-chloroanilino)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@@H]1O[C@@H](Nc2ccc(Cl)cc2)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H16ClNO5/c13-6-1-3-7(4-2-6)14-12-11(18)10(17)9(16)8(5-15)19-12/h1-4,8-12,14-18H,5H2/t8-,9+,10+,11+,12+/m0/s1 |
| InChIKey | IMPAWVRZOFUWFL-VSSNEEPJSA-N |
| XLogP | -0.45 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |