C20H36FNO5Si — CID 71614648
[(3aR,4Z,6R,6aR)-4-(1-fluoro-2-morpholin-4-ylethylidene)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 71614648) has the molecular formula C20H36FNO5Si and a molecular weight of 417.59 g/mol. Its IUPAC name is [(3aR,4Z,6R,6aR)-4-(1-fluoro-2-morpholin-4-ylethylidene)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4Z,6R,6aR)-4-(1-fluoro-2-morpholin-4-ylethylidene)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 71614648 |
| Molecular Formula | C20H36FNO5Si |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | [(3aR,4Z,6R,6aR)-4-(1-fluoro-2-morpholin-4-ylethylidene)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O/C(=C(\F)CN3CCOCC3)[C@@H]2O1 |
| InChI | InChI=1S/C20H36FNO5Si/c1-19(2,3)28(6,7)24-13-15-17-18(27-20(4,5)26-17)16(25-15)14(21)12-22-8-10-23-11-9-22/h15,17-18H,8-13H2,1-7H3/b16-14-/t15-,17-,18+/m1/s1 |
| InChIKey | DBSYUTUOGLUOOO-JLGPTTMLSA-N |
| XLogP | 3.44 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|