C47H52O — CID 71614995
5,12,21,28-tetratert-butyl-16-methoxyheptacyclo[16.12.0.02,15.03,8.09,14.019,24.025,30]triaconta-1,3(8),4,6,9(14),10,12,15,17,19(24),20,22,25(30),26,28-pentadecaene (PubChem CID 71614995) has the molecular formula C47H52O and a molecular weight of 632.93 g/mol. Its IUPAC name is 5,12,21,28-tetratert-butyl-16-methoxyheptacyclo[16.12.0.02,15.03,8.09,14.019,24.025,30]triaconta-1,3(8),4,6,9(14),10,12,15,17,19(24),20,22,25(30),26,28-pentadecaene.
| Compound Name | 5,12,21,28-tetratert-butyl-16-methoxyheptacyclo[16.12.0.02,15.03,8.09,14.019,24.025,30]triaconta-1,3(8),4,6,9(14),10,12,15,17,19(24),20,22,25(30),26,28-pentadecaene |
|---|---|
| PubChem CID | 71614995 |
| Molecular Formula | C47H52O |
| Molecular Weight | 632.93 g/mol |
| Exact Mass | 632.40 |
| IUPAC Name | 5,12,21,28-tetratert-butyl-16-methoxyheptacyclo[16.12.0.02,15.03,8.09,14.019,24.025,30]triaconta-1,3(8),4,6,9(14),10,12,15,17,19(24),20,22,25(30),26,28-pentadecaene |
| SMILES | COc1cc2c3cc(C(C)(C)C)ccc3c3ccc(C(C)(C)C)cc3c2c2c3cc(C(C)(C)C)ccc3c3ccc(C(C)(C)C)cc3c12 |
| InChI | InChI=1S/C47H52O/c1-44(2,3)27-14-18-31-32-19-15-28(45(4,5)6)23-36(32)41-39(35(31)22-27)26-40(48-13)42-37-24-29(46(7,8)9)16-20-33(37)34-21-17-30(47(10,11)12)25-38(34)43(41)42/h14-26H,1-13H3 |
| InChIKey | WGUIYQVRCNEKDT-UHFFFAOYSA-N |
| XLogP | 13.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.93 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|