C19H32N2O6 — CID 71615075
(E,2R,3R,4S,5R)-7-cyclopentyl-3,4,5-trihydroxy-2-methoxy-N-[(3S)-2-oxoazepan-3-yl]hept-6-enamide (PubChem CID 71615075) has the molecular formula C19H32N2O6 and a molecular weight of 384.47 g/mol. Its IUPAC name is (E,2R,3R,4S,5R)-7-cyclopentyl-3,4,5-trihydroxy-2-methoxy-N-[(3S)-2-oxoazepan-3-yl]hept-6-enamide.
| Compound Name | (E,2R,3R,4S,5R)-7-cyclopentyl-3,4,5-trihydroxy-2-methoxy-N-[(3S)-2-oxoazepan-3-yl]hept-6-enamide |
|---|---|
| PubChem CID | 71615075 |
| Molecular Formula | C19H32N2O6 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (E,2R,3R,4S,5R)-7-cyclopentyl-3,4,5-trihydroxy-2-methoxy-N-[(3S)-2-oxoazepan-3-yl]hept-6-enamide |
| SMILES | CO[C@@H](C(=O)N[C@H]1CCCCNC1=O)[C@H](O)[C@@H](O)[C@H](O)/C=C/C1CCCC1 |
| InChI | InChI=1S/C19H32N2O6/c1-27-17(19(26)21-13-8-4-5-11-20-18(13)25)16(24)15(23)14(22)10-9-12-6-2-3-7-12/h9-10,12-17,22-24H,2-8,11H2,1H3,(H,20,25)(H,21,26)/b10-9+/t13-,14+,15-,16+,17+/m0/s1 |
| InChIKey | QDBBUTSZLJSFDJ-FGCKODAMSA-N |
| XLogP | -0.38 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|