C26H21N4+ — CID 71615197
5-ethyl-3,10-diphenyl-2,8,11-triaza-5-azoniatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7,9,12,14-heptaene (PubChem CID 71615197) has the molecular formula C26H21N4+ and a molecular weight of 389.48 g/mol. Its IUPAC name is 5-ethyl-3,10-diphenyl-2,8,11-triaza-5-azoniatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7,9,12,14-heptaene.
| Compound Name | 5-ethyl-3,10-diphenyl-2,8,11-triaza-5-azoniatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7,9,12,14-heptaene |
|---|---|
| PubChem CID | 71615197 |
| Molecular Formula | C26H21N4+ |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 5-ethyl-3,10-diphenyl-2,8,11-triaza-5-azoniatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7,9,12,14-heptaene |
| SMILES | CC[n+]1cc(-c2ccccc2)n2c3ccccc3n3c(-c4ccccc4)cnc3c21 |
| InChI | InChI=1S/C26H21N4/c1-2-28-18-24(20-13-7-4-8-14-20)30-22-16-10-9-15-21(22)29-23(17-27-25(29)26(28)30)19-11-5-3-6-12-19/h3-18H,2H2,1H3/q+1 |
| InChIKey | LXQBOABUZJMBBX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 25.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|