C34H41NO5 — CID 71615291
[4-[5-[(1R,2S,4aS,7S,8aR)-4,7-dimethyl-1-[(E)-prop-1-enyl]-1,2,4a,5,6,7,8,8a-octahydronaphthalene-2-carbonyl]-4-hydroxy-6-oxo-1H-pyridin-3-yl]phenyl] cyclohexanecarboxylate (PubChem CID 71615291) has the molecular formula C34H41NO5 and a molecular weight of 543.70 g/mol. Its IUPAC name is [4-[5-[(1R,2S,4aS,7S,8aR)-4,7-dimethyl-1-[(E)-prop-1-enyl]-1,2,4a,5,6,7,8,8a-octahydronaphthalene-2-carbonyl]-4-hydroxy-6-oxo-1H-pyridin-3-yl]phenyl] cyclohexanecarboxylate.
| Compound Name | [4-[5-[(1R,2S,4aS,7S,8aR)-4,7-dimethyl-1-[(E)-prop-1-enyl]-1,2,4a,5,6,7,8,8a-octahydronaphthalene-2-carbonyl]-4-hydroxy-6-oxo-1H-pyridin-3-yl]phenyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 71615291 |
| Molecular Formula | C34H41NO5 |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | [4-[5-[(1R,2S,4aS,7S,8aR)-4,7-dimethyl-1-[(E)-prop-1-enyl]-1,2,4a,5,6,7,8,8a-octahydronaphthalene-2-carbonyl]-4-hydroxy-6-oxo-1H-pyridin-3-yl]phenyl] cyclohexanecarboxylate |
| SMILES | C/C=C/[C@@H]1[C@H]2C[C@@H](C)CC[C@@H]2C(C)=C[C@H]1C(=O)c1c(O)c(-c2ccc(OC(=O)C3CCCCC3)cc2)c[nH]c1=O |
| InChI | InChI=1S/C34H41NO5/c1-4-8-26-27-17-20(2)11-16-25(27)21(3)18-28(26)31(36)30-32(37)29(19-35-33(30)38)22-12-14-24(15-13-22)40-34(39)23-9-6-5-7-10-23/h4,8,12-15,18-20,23,25-28H,5-7,9-11,16-17H2,1-3H3,(H2,35,37,38)/b8-4+/t20-,25+,26+,27-,28+/m0/s1 |
| InChIKey | IIZASOALOYZMIG-XBCQLVFOSA-N |
| XLogP | 7.24 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|