C14H16N2O2 — CID 71615677
trans-(1R,2R)-2-(1H-indol-5-yl)-N-methoxy-N-methylcyclopropane-1-carboxamide (PubChem CID 71615677) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is trans-(1R,2R)-2-(1H-indol-5-yl)-N-methoxy-N-methylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-(1H-indol-5-yl)-N-methoxy-N-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 71615677 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | trans-(1R,2R)-2-(1H-indol-5-yl)-N-methoxy-N-methylcyclopropane-1-carboxamide |
| SMILES | CON(C)C(=O)[C@@H]1C[C@H]1c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C14H16N2O2/c1-16(18-2)14(17)12-8-11(12)9-3-4-13-10(7-9)5-6-15-13/h3-7,11-12,15H,8H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | YEXITQJEFQWERN-NWDGAFQWSA-N |
| XLogP | 2.29 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|