C29H33ClN4O4 — CID 71615680
benzyl N-[(2S)-3-[4-(3-chlorophenyl)phenyl]-1-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 71615680) has the molecular formula C29H33ClN4O4 and a molecular weight of 537.06 g/mol. Its IUPAC name is benzyl N-[(2S)-3-[4-(3-chlorophenyl)phenyl]-1-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-3-[4-(3-chlorophenyl)phenyl]-1-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 71615680 |
| Molecular Formula | C29H33ClN4O4 |
| Molecular Weight | 537.06 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | benzyl N-[(2S)-3-[4-(3-chlorophenyl)phenyl]-1-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | NCCCC[C@H](NC(=O)[C@H](Cc1ccc(-c2cccc(Cl)c2)cc1)NC(=O)OCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C29H33ClN4O4/c30-24-10-6-9-23(18-24)22-14-12-20(13-15-22)17-26(28(36)33-25(27(32)35)11-4-5-16-31)34-29(37)38-19-21-7-2-1-3-8-21/h1-3,6-10,12-15,18,25-26H,4-5,11,16-17,19,31H2,(H2,32,35)(H,33,36)(H,34,37)/t25-,26-/m0/s1 |
| InChIKey | APBQDXVAHFRLOH-UIOOFZCWSA-N |
| XLogP | 3.94 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.06 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|