C20H31N5O6 — CID 71615779
tert-butyl 2-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-10,12-dioxo-1,3,5,7,11-pentazatricyclo[7.3.1.05,13]tridec-9(13)-en-7-yl]acetate (PubChem CID 71615779) has the molecular formula C20H31N5O6 and a molecular weight of 437.50 g/mol. Its IUPAC name is tert-butyl 2-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-10,12-dioxo-1,3,5,7,11-pentazatricyclo[7.3.1.05,13]tridec-9(13)-en-7-yl]acetate.
| Compound Name | tert-butyl 2-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-10,12-dioxo-1,3,5,7,11-pentazatricyclo[7.3.1.05,13]tridec-9(13)-en-7-yl]acetate |
|---|---|
| PubChem CID | 71615779 |
| Molecular Formula | C20H31N5O6 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | tert-butyl 2-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-10,12-dioxo-1,3,5,7,11-pentazatricyclo[7.3.1.05,13]tridec-9(13)-en-7-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1Cc2c3n(c(=O)[nH]c2=O)CN(CC(=O)OC(C)(C)C)CN3C1 |
| InChI | InChI=1S/C20H31N5O6/c1-19(2,3)30-14(26)8-22-7-13-16(28)21-18(29)25-12-23(11-24(10-22)17(13)25)9-15(27)31-20(4,5)6/h7-12H2,1-6H3,(H,21,28,29) |
| InChIKey | JQQIAJHBBJJLLB-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |