C31H28Cl2F3NO12 — CID 71616331
methyl 6-(2,4-dichlorophenyl)-1-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4-(trifluoromethyl)indole-2-carboxylate (PubChem CID 71616331) has the molecular formula C31H28Cl2F3NO12 and a molecular weight of 734.46 g/mol. Its IUPAC name is methyl 6-(2,4-dichlorophenyl)-1-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4-(trifluoromethyl)indole-2-carboxylate.
| Compound Name | methyl 6-(2,4-dichlorophenyl)-1-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4-(trifluoromethyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 71616331 |
| Molecular Formula | C31H28Cl2F3NO12 |
| Molecular Weight | 734.46 g/mol |
| Exact Mass | 733.09 |
| IUPAC Name | methyl 6-(2,4-dichlorophenyl)-1-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4-(trifluoromethyl)indole-2-carboxylate |
| SMILES | COC(=O)c1cc2c(C(F)(F)F)cc(-c3ccc(Cl)cc3Cl)cc2n1O[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C31H28Cl2F3NO12/c1-13(38)44-12-25-26(45-14(2)39)27(46-15(3)40)28(47-16(4)41)30(48-25)49-37-23-9-17(19-7-6-18(32)10-22(19)33)8-21(31(34,35)36)20(23)11-24(37)29(42)43-5/h6-11,25-28,30H,12H2,1-5H3/t25-,26-,27+,28-,30+/m1/s1 |
| InChIKey | UPSHDKDVMHCSEG-IXMSMLDRSA-N |
| XLogP | 4.93 |
| TPSA | 154.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|