C17H20BN3O3S — CID 71616550
[(1R)-1-[3-(2-methylbenzimidazol-1-yl)propanoylamino]-2-thiophen-3-ylethyl]boronic acid (PubChem CID 71616550) has the molecular formula C17H20BN3O3S and a molecular weight of 357.24 g/mol. Its IUPAC name is [(1R)-1-[3-(2-methylbenzimidazol-1-yl)propanoylamino]-2-thiophen-3-ylethyl]boronic acid.
| Compound Name | [(1R)-1-[3-(2-methylbenzimidazol-1-yl)propanoylamino]-2-thiophen-3-ylethyl]boronic acid |
|---|---|
| PubChem CID | 71616550 |
| Molecular Formula | C17H20BN3O3S |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | [(1R)-1-[3-(2-methylbenzimidazol-1-yl)propanoylamino]-2-thiophen-3-ylethyl]boronic acid |
| SMILES | Cc1nc2ccccc2n1CCC(=O)N[C@@H](Cc1ccsc1)B(O)O |
| InChI | InChI=1S/C17H20BN3O3S/c1-12-19-14-4-2-3-5-15(14)21(12)8-6-17(22)20-16(18(23)24)10-13-7-9-25-11-13/h2-5,7,9,11,16,23-24H,6,8,10H2,1H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | GRVRSCPIKIMHBR-INIZCTEOSA-N |
| XLogP | 1.54 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|