C25H22FN5O6 — CID 71616800
N-[4-[4-(4-benzyl-5-oxo-1,3,4-oxadiazol-2-yl)piperidin-1-yl]-3-fluorophenyl]-5-nitrofuran-2-carboxamide (PubChem CID 71616800) has the molecular formula C25H22FN5O6 and a molecular weight of 507.48 g/mol. Its IUPAC name is N-[4-[4-(4-benzyl-5-oxo-1,3,4-oxadiazol-2-yl)piperidin-1-yl]-3-fluorophenyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[4-[4-(4-benzyl-5-oxo-1,3,4-oxadiazol-2-yl)piperidin-1-yl]-3-fluorophenyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 71616800 |
| Molecular Formula | C25H22FN5O6 |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | N-[4-[4-(4-benzyl-5-oxo-1,3,4-oxadiazol-2-yl)piperidin-1-yl]-3-fluorophenyl]-5-nitrofuran-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCC(c3nn(Cc4ccccc4)c(=O)o3)CC2)c(F)c1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C25H22FN5O6/c26-19-14-18(27-23(32)21-8-9-22(36-21)31(34)35)6-7-20(19)29-12-10-17(11-13-29)24-28-30(25(33)37-24)15-16-4-2-1-3-5-16/h1-9,14,17H,10-13,15H2,(H,27,32) |
| InChIKey | LFHRLUYKPXXSJH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|