C11H13BFNO4 — CID 71616994
[(3S,11R)-3-(aminomethyl)-5-fluoro-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-11-yl]methanol (PubChem CID 71616994) has the molecular formula C11H13BFNO4 and a molecular weight of 253.04 g/mol. Its IUPAC name is [(3S,11R)-3-(aminomethyl)-5-fluoro-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-11-yl]methanol.
| Compound Name | [(3S,11R)-3-(aminomethyl)-5-fluoro-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-11-yl]methanol |
|---|---|
| PubChem CID | 71616994 |
| Molecular Formula | C11H13BFNO4 |
| Molecular Weight | 253.04 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | [(3S,11R)-3-(aminomethyl)-5-fluoro-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-11-yl]methanol |
| SMILES | NC[C@H]1OB2O[C@H](CO)COc3ccc(F)c1c32 |
| InChI | InChI=1S/C11H13BFNO4/c13-7-1-2-8-11-10(7)9(3-14)18-12(11)17-6(4-15)5-16-8/h1-2,6,9,15H,3-5,14H2/t6-,9-/m1/s1 |
| InChIKey | VBDZGHLEDPSHKM-HZGVNTEJSA-N |
| XLogP | -0.68 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.04 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|