C19H17N5O2 — CID 71617343
6-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-[1,3]dioxolo[4,5-g]quinoline (PubChem CID 71617343) has the molecular formula C19H17N5O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 6-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-[1,3]dioxolo[4,5-g]quinoline.
| Compound Name | 6-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-[1,3]dioxolo[4,5-g]quinoline |
|---|---|
| PubChem CID | 71617343 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 6-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-[1,3]dioxolo[4,5-g]quinoline |
| SMILES | Cc1ncc(C)n2nc(CCc3ccc4cc5c(cc4n3)OCO5)nc12 |
| InChI | InChI=1S/C19H17N5O2/c1-11-9-20-12(2)19-22-18(23-24(11)19)6-5-14-4-3-13-7-16-17(26-10-25-16)8-15(13)21-14/h3-4,7-9H,5-6,10H2,1-2H3 |
| InChIKey | OBKFPUPSZAQTJF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 74.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |