About N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-6-morpholin-4-yl-2,7-naphthyridin-1-amine
N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-6-morpholin-4-yl-2,7-naphthyridin-1-amine (PubChem CID 71618006) has the molecular formula C25H25N5O
and a molecular weight of 411.51 g/mol. Its IUPAC name is N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-6-morpholin-4-yl-2,7-naphthyridin-1-amine.
Molecular Properties
| Compound Name | N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-6-morpholin-4-yl-2,7-naphthyridin-1-amine |
| PubChem CID | 71618006 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-6-morpholin-4-yl-2,7-naphthyridin-1-amine |
| SMILES | Cc1cc(-c2ccc(CNc3nccc4cc(N5CCOCC5)ncc34)cc2)ccn1 |
| InChI | InChI=1S/C25H25N5O/c1-18-14-21(6-8-26-18)20-4-2-19(3-5-20)16-29-25-23-17-28-24(15-22(23)7-9-27-25)30-10-12-31-13-11-30/h2-9,14-15,17H,10-13,16H2,1H3,(H,27,29) |
| InChIKey | OSWOYAYEGAZTOF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-6-morpholin-4-yl-2,7-naphthyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-6-morpholin-4-yl-2,7-naphthyridin-1-amine?
The IUPAC name of N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-6-morpholin-4-yl-2,7-naphthyridin-1-amine (CID 71618006) is N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-6-morpholin-4-yl-2,7-naphthyridin-1-amine.
What is the SMILES notation for N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-6-morpholin-4-yl-2,7-naphthyridin-1-amine?
The canonical SMILES for N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-6-morpholin-4-yl-2,7-naphthyridin-1-amine is Cc1cc(-c2ccc(CNc3nccc4cc(N5CCOCC5)ncc34)cc2)ccn1.
What is the InChIKey of N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-6-morpholin-4-yl-2,7-naphthyridin-1-amine?
The InChIKey is OSWOYAYEGAZTOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25N5O/c1-18-14-21(6-8-26-18)20-4-2-19(3-5-20)16-29-25-23-17-28-24(15-22(23)7-9-27-25)30-10-12-31-13-11-30/h2-9,14-15,17H,10-13,16H2,1H3,(H,27,29).
What are the key properties of N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-6-morpholin-4-yl-2,7-naphthyridin-1-amine?
N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-6-morpholin-4-yl-2,7-naphthyridin-1-amine has a molecular weight of 411.51 g/mol, XLogP of 4.45, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-6-morpholin-4-yl-2,7-naphthyridin-1-amine is sourced from PubChem (CID 71618006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).