C49H48F2O6 — CID 71618045
1-[(1S,3R,4R,5S,6R)-2,2-difluoro-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexyl]oxy-2-[(4-methoxyphenyl)methyl]benzene (PubChem CID 71618045) has the molecular formula C49H48F2O6 and a molecular weight of 770.91 g/mol. Its IUPAC name is 1-[(1S,3R,4R,5S,6R)-2,2-difluoro-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexyl]oxy-2-[(4-methoxyphenyl)methyl]benzene.
| Compound Name | 1-[(1S,3R,4R,5S,6R)-2,2-difluoro-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexyl]oxy-2-[(4-methoxyphenyl)methyl]benzene |
|---|---|
| PubChem CID | 71618045 |
| Molecular Formula | C49H48F2O6 |
| Molecular Weight | 770.91 g/mol |
| Exact Mass | 770.34 |
| IUPAC Name | 1-[(1S,3R,4R,5S,6R)-2,2-difluoro-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexyl]oxy-2-[(4-methoxyphenyl)methyl]benzene |
| SMILES | COc1ccc(Cc2ccccc2O[C@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)C2(F)F)cc1 |
| InChI | InChI=1S/C49H48F2O6/c1-52-42-28-26-36(27-29-42)30-41-24-14-15-25-44(41)57-48-47(56-34-40-22-12-5-13-23-40)46(55-33-39-20-10-4-11-21-39)45(54-32-38-18-8-3-9-19-38)43(49(48,50)51)35-53-31-37-16-6-2-7-17-37/h2-29,43,45-48H,30-35H2,1H3/t43-,45-,46+,47-,48+/m1/s1 |
| InChIKey | NZEAYJZKRYSZSN-RXNGZXBYSA-N |
| XLogP | 10.27 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.91 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |