C21H19N3O5S — CID 71618619
N-[4-[2-(furan-2-carbonyl)-3-(2-hydroxyphenyl)-1,3-dihydropyrazol-5-yl]phenyl]methanesulfonamide (PubChem CID 71618619) has the molecular formula C21H19N3O5S and a molecular weight of 425.47 g/mol. Its IUPAC name is N-[4-[2-(furan-2-carbonyl)-3-(2-hydroxyphenyl)-1,3-dihydropyrazol-5-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-(furan-2-carbonyl)-3-(2-hydroxyphenyl)-1,3-dihydropyrazol-5-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 71618619 |
| Molecular Formula | C21H19N3O5S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | N-[4-[2-(furan-2-carbonyl)-3-(2-hydroxyphenyl)-1,3-dihydropyrazol-5-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(C2=CC(c3ccccc3O)N(C(=O)c3ccco3)N2)cc1 |
| InChI | InChI=1S/C21H19N3O5S/c1-30(27,28)23-15-10-8-14(9-11-15)17-13-18(16-5-2-3-6-19(16)25)24(22-17)21(26)20-7-4-12-29-20/h2-13,18,22-23,25H,1H3 |
| InChIKey | LGZDGEYNWUHKKB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|